C8H5BrF4 — CID 171649780
1-bromo-4-(2,2-difluoroethyl)-2,5-difluorobenzene (PubChem CID 171649780) has the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. Its IUPAC name is 1-bromo-4-(2,2-difluoroethyl)-2,5-difluorobenzene.
| Compound Name | 1-bromo-4-(2,2-difluoroethyl)-2,5-difluorobenzene |
|---|---|
| PubChem CID | 171649780 |
| Molecular Formula | C8H5BrF4 |
| Molecular Weight | 257.02 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 1-bromo-4-(2,2-difluoroethyl)-2,5-difluorobenzene |
| SMILES | Fc1cc(CC(F)F)c(F)cc1Br |
| InChI | InChI=1S/C8H5BrF4/c9-5-3-6(10)4(1-7(5)11)2-8(12)13/h1,3,8H,2H2 |
| InChIKey | AIBZJSWNSOVYBO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.02 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|