C12H12Br2F2O — CID 107616973
2-bromo-1-(4-bromo-2,5-difluorophenyl)-4-methylpentan-3-one (PubChem CID 107616973) has the molecular formula C12H12Br2F2O and a molecular weight of 370.03 g/mol. Its IUPAC name is 2-bromo-1-(4-bromo-2,5-difluorophenyl)-4-methylpentan-3-one.
| Compound Name | 2-bromo-1-(4-bromo-2,5-difluorophenyl)-4-methylpentan-3-one |
|---|---|
| PubChem CID | 107616973 |
| Molecular Formula | C12H12Br2F2O |
| Molecular Weight | 370.03 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 2-bromo-1-(4-bromo-2,5-difluorophenyl)-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)C(Br)Cc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H12Br2F2O/c1-6(2)12(17)9(14)3-7-4-11(16)8(13)5-10(7)15/h4-6,9H,3H2,1-2H3 |
| InChIKey | VUENPIJBVLTAFS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.03 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|