C9H8BrF2NO — CID 104512951
2-bromo-3-(2,4-difluorophenyl)propanamide (PubChem CID 104512951) has the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. Its IUPAC name is 2-bromo-3-(2,4-difluorophenyl)propanamide.
| Compound Name | 2-bromo-3-(2,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 104512951 |
| Molecular Formula | C9H8BrF2NO |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2-bromo-3-(2,4-difluorophenyl)propanamide |
| SMILES | NC(=O)C(Br)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C9H8BrF2NO/c10-7(9(13)14)3-5-1-2-6(11)4-8(5)12/h1-2,4,7H,3H2,(H2,13,14) |
| InChIKey | VHMBTRNYLHAWFB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|