C8H7BrF2 — CID 126670968
3-bromo-1-ethyl-2,4-difluorobenzene (PubChem CID 126670968) has the molecular formula C8H7BrF2 and a molecular weight of 221.04 g/mol. Its IUPAC name is 3-bromo-1-ethyl-2,4-difluorobenzene.
| Compound Name | 3-bromo-1-ethyl-2,4-difluorobenzene |
|---|---|
| PubChem CID | 126670968 |
| Molecular Formula | C8H7BrF2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 3-bromo-1-ethyl-2,4-difluorobenzene |
| SMILES | CCc1ccc(F)c(Br)c1F |
| InChI | InChI=1S/C8H7BrF2/c1-2-5-3-4-6(10)7(9)8(5)11/h3-4H,2H2,1H3 |
| InChIKey | HXFVGCTUPANDSO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|