C22H14N4 — CID 59700396
4-[2-(3,4-diisocyano-2,5-dimethylphenyl)ethynyl]-3,6-dimethylbenzene-1,2-dicarbonitrile (PubChem CID 59700396) has the molecular formula C22H14N4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-[2-(3,4-diisocyano-2,5-dimethylphenyl)ethynyl]-3,6-dimethylbenzene-1,2-dicarbonitrile.
| Compound Name | 4-[2-(3,4-diisocyano-2,5-dimethylphenyl)ethynyl]-3,6-dimethylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 59700396 |
| Molecular Formula | C22H14N4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-[2-(3,4-diisocyano-2,5-dimethylphenyl)ethynyl]-3,6-dimethylbenzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(C)cc(C#Cc2cc(C)c(C#N)c(C#N)c2C)c(C)c1[N+]#[C-] |
| InChI | InChI=1S/C22H14N4/c1-13-9-17(15(3)20(12-24)19(13)11-23)7-8-18-10-14(2)21(25-5)22(26-6)16(18)4/h9-10H,1-4H3 |
| InChIKey | MNTBOGKGYGRYPM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|