C44H51N3Si2 — CID 158905195
8,9-diisocyano-3-methyl-7,10-bis[2-tri(propan-2-yl)silylethynyl]tetracene-2-carbonitrile (PubChem CID 158905195) has the molecular formula C44H51N3Si2 and a molecular weight of 678.09 g/mol. Its IUPAC name is 8,9-diisocyano-3-methyl-7,10-bis[2-tri(propan-2-yl)silylethynyl]tetracene-2-carbonitrile.
| Compound Name | 8,9-diisocyano-3-methyl-7,10-bis[2-tri(propan-2-yl)silylethynyl]tetracene-2-carbonitrile |
|---|---|
| PubChem CID | 158905195 |
| Molecular Formula | C44H51N3Si2 |
| Molecular Weight | 678.09 g/mol |
| Exact Mass | 677.36 |
| IUPAC Name | 8,9-diisocyano-3-methyl-7,10-bis[2-tri(propan-2-yl)silylethynyl]tetracene-2-carbonitrile |
| SMILES | [C-]#[N+]c1c([N+]#[C-])c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc3cc4cc(C#N)c(C)cc4cc3cc2c1C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C44H51N3Si2/c1-27(2)48(28(3)4,29(5)6)18-16-39-41-24-36-21-34-20-33(13)38(26-45)23-35(34)22-37(36)25-42(41)40(44(47-15)43(39)46-14)17-19-49(30(7)8,31(9)10)32(11)12/h20-25,27-32H,1-13H3 |
| InChIKey | JFYNJRPEKMDSKN-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.09 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|