C48H52N4Si2 — CID 177472883
15,26-bis[2-tri(propan-2-yl)silylethynyl]-2,13-diazahexacyclo[12.12.0.03,12.05,10.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16,18,20,22,24-tridecaene-7,8-dicarbonitrile (PubChem CID 177472883) has the molecular formula C48H52N4Si2 and a molecular weight of 741.14 g/mol. Its IUPAC name is 15,26-bis[2-tri(propan-2-yl)silylethynyl]-2,13-diazahexacyclo[12.12.0.03,12.05,10.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16,18,20,22,24-tridecaene-7,8-dicarbonitrile.
| Compound Name | 15,26-bis[2-tri(propan-2-yl)silylethynyl]-2,13-diazahexacyclo[12.12.0.03,12.05,10.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16,18,20,22,24-tridecaene-7,8-dicarbonitrile |
|---|---|
| PubChem CID | 177472883 |
| Molecular Formula | C48H52N4Si2 |
| Molecular Weight | 741.14 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | 15,26-bis[2-tri(propan-2-yl)silylethynyl]-2,13-diazahexacyclo[12.12.0.03,12.05,10.016,25.018,23]hexacosa-1(26),2,4,6,8,10,12,14,16,18,20,22,24-tridecaene-7,8-dicarbonitrile |
| SMILES | CC(C)[Si](C#Cc1c2cc3ccccc3cc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2nc3cc4cc(C#N)c(C#N)cc4cc3nc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C48H52N4Si2/c1-29(2)53(30(3)4,31(5)6)19-17-41-43-23-35-15-13-14-16-36(35)24-44(43)42(18-20-54(32(7)8,33(9)10)34(11)12)48-47(41)51-45-25-37-21-39(27-49)40(28-50)22-38(37)26-46(45)52-48/h13-16,21-26,29-34H,1-12H3 |
| InChIKey | BODURPMXZCLIKO-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.14 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|