C16H10N4 — CID 159762844
6-isocyano-2,7-dimethylphenazine-1-carbonitrile (PubChem CID 159762844) has the molecular formula C16H10N4 and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-isocyano-2,7-dimethylphenazine-1-carbonitrile.
| Compound Name | 6-isocyano-2,7-dimethylphenazine-1-carbonitrile |
|---|---|
| PubChem CID | 159762844 |
| Molecular Formula | C16H10N4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 6-isocyano-2,7-dimethylphenazine-1-carbonitrile |
| SMILES | [C-]#[N+]c1c(C)ccc2nc3c(C#N)c(C)ccc3nc12 |
| InChI | InChI=1S/C16H10N4/c1-9-4-6-12-15(11(9)8-17)19-13-7-5-10(2)14(18-3)16(13)20-12/h4-7H,1-2H3 |
| InChIKey | ZYMVGRJMVJOOLD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|