C68H52N2 — CID 168805997
2,3,4,5-tetrakis(3,6-dimethyl-9H-fluoren-9-yl)-6-isocyanobenzonitrile (PubChem CID 168805997) has the molecular formula C68H52N2 and a molecular weight of 897.18 g/mol. Its IUPAC name is 2,3,4,5-tetrakis(3,6-dimethyl-9H-fluoren-9-yl)-6-isocyanobenzonitrile.
| Compound Name | 2,3,4,5-tetrakis(3,6-dimethyl-9H-fluoren-9-yl)-6-isocyanobenzonitrile |
|---|---|
| PubChem CID | 168805997 |
| Molecular Formula | C68H52N2 |
| Molecular Weight | 897.18 g/mol |
| Exact Mass | 896.41 |
| IUPAC Name | 2,3,4,5-tetrakis(3,6-dimethyl-9H-fluoren-9-yl)-6-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(C2c3ccc(C)cc3-c3cc(C)ccc32)c(C2c3ccc(C)cc3-c3cc(C)ccc32)c(C2c3ccc(C)cc3-c3cc(C)ccc32)c1C1c2ccc(C)cc2-c2cc(C)ccc21 |
| InChI | InChI=1S/C68H52N2/c1-35-10-18-43-51(26-35)52-27-36(2)11-19-44(52)60(43)64-59(34-69)68(70-9)67(63-49-24-16-41(7)32-57(49)58-33-42(8)17-25-50(58)63)66(62-47-22-14-39(5)30-55(47)56-31-40(6)15-23-48(56)62)65(64)61-45-20-12-37(3)28-53(45)54-29-38(4)13-21-46(54)61/h10-33,60-63H,1-8H3 |
| InChIKey | IEGGGAUAGKJWSB-UHFFFAOYSA-N |
| XLogP | 17.22 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.18 |
| LogP ≤ 5 | 17.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|