C42H30N4 — CID 155646748
3-[2,4-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanophenyl]benzonitrile (PubChem CID 155646748) has the molecular formula C42H30N4 and a molecular weight of 590.73 g/mol. Its IUPAC name is 3-[2,4-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanophenyl]benzonitrile.
| Compound Name | 3-[2,4-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanophenyl]benzonitrile |
|---|---|
| PubChem CID | 155646748 |
| Molecular Formula | C42H30N4 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 3-[2,4-bis(3,6-dimethylcarbazol-9-yl)-3-isocyanophenyl]benzonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3ccc(C)cc3c3cc(C)ccc32)ccc(-c2cccc(C#N)c2)c1-n1c2ccc(C)cc2c2cc(C)ccc21 |
| InChI | InChI=1S/C42H30N4/c1-25-9-14-36-32(19-25)33-20-26(2)10-15-37(33)45(36)40-18-13-31(30-8-6-7-29(23-30)24-43)42(41(40)44-5)46-38-16-11-27(3)21-34(38)35-22-28(4)12-17-39(35)46/h6-23H,1-4H3 |
| InChIKey | UXESHQAWGXAQHY-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|