C52H34N4 — CID 146238082
3-(3-cyanophenyl)-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 146238082) has the molecular formula C52H34N4 and a molecular weight of 714.87 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 3-(3-cyanophenyl)-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 146238082 |
| Molecular Formula | C52H34N4 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 714.28 |
| IUPAC Name | 3-(3-cyanophenyl)-2,6-bis[2-(3-methylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cccc(-c2ccc3c4ccccc4n(-c4ccc(-c5cccc(C#N)c5)c(-n5c6ccccc6c6ccc(-c7cccc(C)c7)cc65)c4C#N)c3c2)c1 |
| InChI | InChI=1S/C52H34N4/c1-33-10-7-13-36(26-33)38-20-22-44-42-16-3-5-18-47(42)55(50(44)29-38)49-25-24-41(40-15-9-12-35(28-40)31-53)52(46(49)32-54)56-48-19-6-4-17-43(48)45-23-21-39(30-51(45)56)37-14-8-11-34(2)27-37/h3-30H,1-2H3 |
| InChIKey | DMBGDMUMBMOUMS-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |