C61H38N6 — CID 155427570
3-(3-cyano-5-methylphenyl)-2,6-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile (PubChem CID 155427570) has the molecular formula C61H38N6 and a molecular weight of 855.02 g/mol. Its IUPAC name is 3-(3-cyano-5-methylphenyl)-2,6-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile.
| Compound Name | 3-(3-cyano-5-methylphenyl)-2,6-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 155427570 |
| Molecular Formula | C61H38N6 |
| Molecular Weight | 855.02 g/mol |
| Exact Mass | 854.32 |
| IUPAC Name | 3-(3-cyano-5-methylphenyl)-2,6-bis[3-(6-phenyl-2-pyridinyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C#N)cc(-c2ccc(-n3c4ccccc4c4cc(-c5cccc(-c6ccccc6)n5)ccc43)c(C#N)c2-n2c3ccccc3c3cc(-c4cccc(-c5ccccc5)n4)ccc32)c1 |
| InChI | InChI=1S/C61H38N6/c1-39-32-40(37-62)34-45(33-39)46-28-31-60(66-56-24-10-8-18-47(56)49-35-43(26-29-58(49)66)54-22-12-20-52(64-54)41-14-4-2-5-15-41)51(38-63)61(46)67-57-25-11-9-19-48(57)50-36-44(27-30-59(50)67)55-23-13-21-53(65-55)42-16-6-3-7-17-42/h2-36H,1H3 |
| InChIKey | CZNBLZKHAJVXES-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 83.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.02 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |