C42H33N3 — CID 158960856
3-[4,5-bis(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]benzonitrile (PubChem CID 158960856) has the molecular formula C42H33N3 and a molecular weight of 579.75 g/mol. Its IUPAC name is 3-[4,5-bis(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]benzonitrile.
| Compound Name | 3-[4,5-bis(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]benzonitrile |
|---|---|
| PubChem CID | 158960856 |
| Molecular Formula | C42H33N3 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 3-[4,5-bis(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]benzonitrile |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1cc(C)c(-c2cccc(C#N)c2)cc1-n1c2ccc(C)cc2c2cc(C)ccc21 |
| InChI | InChI=1S/C42H33N3/c1-25-9-13-37-33(17-25)34-18-26(2)10-14-38(34)44(37)41-21-29(5)32(31-8-6-7-30(22-31)24-43)23-42(41)45-39-15-11-27(3)19-35(39)36-20-28(4)12-16-40(36)45/h6-23H,1-5H3 |
| InChIKey | XWANROYDHRIECA-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |