C74H62F3N3 — CID 155377828
3-[2,5-bis[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 155377828) has the molecular formula C74H62F3N3 and a molecular weight of 1050.32 g/mol. Its IUPAC name is 3-[2,5-bis[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[2,5-bis[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155377828 |
| Molecular Formula | C74H62F3N3 |
| Molecular Weight | 1050.32 g/mol |
| Exact Mass | 1049.49 |
| IUPAC Name | 3-[2,5-bis[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2cc(-c4c(C)cc(C)cc4C)ccc2n3-c2cc(C(F)(F)F)c(-n3c4ccc(-c5c(C)cc(C)cc5C)cc4c4cc(-c5c(C)cc(C)cc5C)ccc43)cc2-c2cccc(C#N)c2)c(C)c1 |
| InChI | InChI=1S/C74H62F3N3/c1-40-24-44(5)70(45(6)25-40)54-16-20-64-59(33-54)60-34-55(71-46(7)26-41(2)27-47(71)8)17-21-65(60)79(64)68-38-63(74(75,76)77)69(37-58(68)53-15-13-14-52(32-53)39-78)80-66-22-18-56(72-48(9)28-42(3)29-49(72)10)35-61(66)62-36-57(19-23-67(62)80)73-50(11)30-43(4)31-51(73)12/h13-38H,1-12H3 |
| InChIKey | DYGYALFILNTDKJ-UHFFFAOYSA-N |
| XLogP | 20.81 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.32 |
| LogP ≤ 5 | 20.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |