C52H28F3N5 — CID 142465777
3-[2,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 142465777) has the molecular formula C52H28F3N5 and a molecular weight of 779.83 g/mol. Its IUPAC name is 3-[2,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[2,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 142465777 |
| Molecular Formula | C52H28F3N5 |
| Molecular Weight | 779.83 g/mol |
| Exact Mass | 779.23 |
| IUPAC Name | 3-[2,5-bis[3-(4-cyanophenyl)carbazol-9-yl]-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2cc(C(F)(F)F)c(-n3c4ccccc4c4cc(-c5ccc(C#N)cc5)ccc43)cc2-c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C52H28F3N5/c53-52(54,55)45-28-50(59-46-10-3-1-8-40(46)43-25-37(20-22-48(43)59)35-16-12-32(29-56)13-17-35)42(39-7-5-6-34(24-39)31-58)27-51(45)60-47-11-4-2-9-41(47)44-26-38(21-23-49(44)60)36-18-14-33(30-57)15-19-36/h1-28H |
| InChIKey | QKURCBWMQKCYCG-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.83 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |