C40H26F3N3 — CID 159791827
3-[2,5-bis(1-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 159791827) has the molecular formula C40H26F3N3 and a molecular weight of 605.66 g/mol. Its IUPAC name is 3-[2,5-bis(1-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 3-[2,5-bis(1-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 159791827 |
| Molecular Formula | C40H26F3N3 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 3-[2,5-bis(1-methylcarbazol-9-yl)-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1cccc2c3ccccc3n(-c3cc(C(F)(F)F)c(-n4c5ccccc5c5cccc(C)c54)cc3-c3cccc(C#N)c3)c12 |
| InChI | InChI=1S/C40H26F3N3/c1-24-10-7-16-30-28-14-3-5-18-34(28)45(38(24)30)36-22-33(40(41,42)43)37(21-32(36)27-13-9-12-26(20-27)23-44)46-35-19-6-4-15-29(35)31-17-8-11-25(2)39(31)46/h3-22H,1-2H3 |
| InChIKey | NBZAHENEGSGSJY-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |