C67H33F3N8 — CID 137381406
2,5-bis[3,6-bis(3-cyanophenyl)carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137381406) has the molecular formula C67H33F3N8 and a molecular weight of 1007.05 g/mol. Its IUPAC name is 2,5-bis[3,6-bis(3-cyanophenyl)carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,5-bis[3,6-bis(3-cyanophenyl)carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137381406 |
| Molecular Formula | C67H33F3N8 |
| Molecular Weight | 1007.05 g/mol |
| Exact Mass | 1006.28 |
| IUPAC Name | 2,5-bis[3,6-bis(3-cyanophenyl)carbazol-9-yl]-4-[2-cyano-6-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c(c2)c2cc(-c4cccc(C#N)c4)ccc2n3-c2cc(-c3c(C#N)cccc3C(F)(F)F)c(-n3c4ccc(-c5cccc(C#N)c5)cc4c4cc(-c5cccc(C#N)c5)ccc43)cc2C#N)c1 |
| InChI | InChI=1S/C67H33F3N8/c68-67(69,70)59-15-5-14-52(38-75)66(59)58-33-64(77-60-20-16-48(44-10-1-6-40(24-44)34-71)28-54(60)55-29-49(17-21-61(55)77)45-11-2-7-41(25-45)35-72)53(39-76)32-65(58)78-62-22-18-50(46-12-3-8-42(26-46)36-73)30-56(62)57-31-51(19-23-63(57)78)47-13-4-9-43(27-47)37-74/h1-33H |
| InChIKey | FGEPBNUDEKIICP-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 152.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.05 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |