C56H42N4 — CID 155647004
3-[2-isocyano-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzonitrile (PubChem CID 155647004) has the molecular formula C56H42N4 and a molecular weight of 770.98 g/mol. Its IUPAC name is 3-[2-isocyano-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzonitrile.
| Compound Name | 3-[2-isocyano-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 155647004 |
| Molecular Formula | C56H42N4 |
| Molecular Weight | 770.98 g/mol |
| Exact Mass | 770.34 |
| IUPAC Name | 3-[2-isocyano-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-n2c3ccccc3c3cc(-c4c(C)cc(C)cc4C)ccc32)c(-n2c3ccccc3c3cc(-c4c(C)cc(C)cc4C)ccc32)cc1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C56H42N4/c1-33-23-35(3)55(36(4)24-33)41-19-21-51-46(28-41)43-15-8-10-17-49(43)59(51)53-30-45(40-14-12-13-39(27-40)32-57)48(58-7)31-54(53)60-50-18-11-9-16-44(50)47-29-42(20-22-52(47)60)56-37(5)25-34(2)26-38(56)6/h8-31H,1-6H3 |
| InChIKey | QZHCTYXBHVDHSS-UHFFFAOYSA-N |
| XLogP | 15.15 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.98 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|