C11H11N3 — CID 21025755
2-amino-1,5-dimethylindole-3-carbonitrile (PubChem CID 21025755) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-amino-1,5-dimethylindole-3-carbonitrile.
| Compound Name | 2-amino-1,5-dimethylindole-3-carbonitrile |
|---|---|
| PubChem CID | 21025755 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-amino-1,5-dimethylindole-3-carbonitrile |
| SMILES | Cc1ccc2c(c1)c(C#N)c(N)n2C |
| InChI | InChI=1S/C11H11N3/c1-7-3-4-10-8(5-7)9(6-12)11(13)14(10)2/h3-5H,13H2,1-2H3 |
| InChIKey | RZCRSDUJNKKTAX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |