About CID 166142135
CID 166142135 (PubChem CID 166142135) has the molecular formula C11H9BN2
and a molecular weight of 180.02 g/mol.
Molecular Properties
| Compound Name | CID 166142135 |
| PubChem CID | 166142135 |
| Molecular Formula | C11H9BN2 |
| Molecular Weight | 180.02 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c(C#N)c(C)n2C |
| InChI | InChI=1S/C11H9BN2/c1-7-10(6-13)9-5-8(12)3-4-11(9)14(7)2/h3-5H,1-2H3 |
| InChIKey | MKIKSYINUKOKFE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.02 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166142135 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166142135?
The IUPAC name of CID 166142135 (CID 166142135) is not available.
What is the SMILES notation for CID 166142135?
The canonical SMILES for CID 166142135 is [B]c1ccc2c(c1)c(C#N)c(C)n2C.
What is the InChIKey of CID 166142135?
The InChIKey is MKIKSYINUKOKFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BN2/c1-7-10(6-13)9-5-8(12)3-4-11(9)14(7)2/h3-5H,1-2H3.
What are the key properties of CID 166142135?
CID 166142135 has a molecular weight of 180.02 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166142135 is sourced from PubChem (CID 166142135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).