C14H10N2O2 — CID 12628424
5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carbonitrile (PubChem CID 12628424) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carbonitrile.
| Compound Name | 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carbonitrile |
|---|---|
| PubChem CID | 12628424 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5,8-dimethyl-4-oxopyrano[3,2-b]indole-2-carbonitrile |
| SMILES | Cc1ccc2c(c1)c1oc(C#N)cc(=O)c1n2C |
| InChI | InChI=1S/C14H10N2O2/c1-8-3-4-11-10(5-8)14-13(16(11)2)12(17)6-9(7-15)18-14/h3-6H,1-2H3 |
| InChIKey | DNLNFVQVJPQKDA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |