C11H13NS — CID 142076478
1,2,5-trimethylindole-3-thiol (PubChem CID 142076478) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 1,2,5-trimethylindole-3-thiol.
| Compound Name | 1,2,5-trimethylindole-3-thiol |
|---|---|
| PubChem CID | 142076478 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1,2,5-trimethylindole-3-thiol |
| SMILES | Cc1ccc2c(c1)c(S)c(C)n2C |
| InChI | InChI=1S/C11H13NS/c1-7-4-5-10-9(6-7)11(13)8(2)12(10)3/h4-6,13H,1-3H3 |
| InChIKey | HERDIZFCTCWPEE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|