C16H24N2 — CID 170866976
N,N-dimethyl-3-(1,2,5-trimethylindol-3-yl)propan-1-amine (PubChem CID 170866976) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N,N-dimethyl-3-(1,2,5-trimethylindol-3-yl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(1,2,5-trimethylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 170866976 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N,N-dimethyl-3-(1,2,5-trimethylindol-3-yl)propan-1-amine |
| SMILES | Cc1ccc2c(c1)c(CCCN(C)C)c(C)n2C |
| InChI | InChI=1S/C16H24N2/c1-12-8-9-16-15(11-12)14(13(2)18(16)5)7-6-10-17(3)4/h8-9,11H,6-7,10H2,1-5H3 |
| InChIKey | ZCGVOGXLMYMFRZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|