C15H22N2 — CID 170867038
3-(1,5-dimethylindol-2-yl)-N,N-dimethylpropan-1-amine (PubChem CID 170867038) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(1,5-dimethylindol-2-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(1,5-dimethylindol-2-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170867038 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(1,5-dimethylindol-2-yl)-N,N-dimethylpropan-1-amine |
| SMILES | Cc1ccc2c(c1)cc(CCCN(C)C)n2C |
| InChI | InChI=1S/C15H22N2/c1-12-7-8-15-13(10-12)11-14(17(15)4)6-5-9-16(2)3/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | GCKAEORXKSRJRR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |