C71H42N4 — CID 158953313
4-carbazol-9-yl-2,6-bis(3,6-diphenyl-9H-fluoren-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile (PubChem CID 158953313) has the molecular formula C71H42N4 and a molecular weight of 951.15 g/mol. Its IUPAC name is 4-carbazol-9-yl-2,6-bis(3,6-diphenyl-9H-fluoren-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile.
| Compound Name | 4-carbazol-9-yl-2,6-bis(3,6-diphenyl-9H-fluoren-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 158953313 |
| Molecular Formula | C71H42N4 |
| Molecular Weight | 951.15 g/mol |
| Exact Mass | 950.34 |
| IUPAC Name | 4-carbazol-9-yl-2,6-bis(3,6-diphenyl-9H-fluoren-9-yl)-5-isocyanobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(C2c3ccc(-c4ccccc4)cc3-c3cc(-c4ccccc4)ccc32)c(C#N)c(C2c3ccc(-c4ccccc4)cc3-c3cc(-c4ccccc4)ccc32)c(C#N)c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C71H42N4/c1-74-70-69(67-56-36-32-50(46-22-10-4-11-23-46)40-60(56)61-41-51(33-37-57(61)67)47-24-12-5-13-25-47)62(42-72)68(63(43-73)71(70)75-64-28-16-14-26-52(64)53-27-15-17-29-65(53)75)66-54-34-30-48(44-18-6-2-7-19-44)38-58(54)59-39-49(31-35-55(59)66)45-20-8-3-9-21-45/h2-41,66-67H |
| InChIKey | LGACZPANCBVFLG-UHFFFAOYSA-N |
| XLogP | 18.07 |
| TPSA | 56.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.15 |
| LogP ≤ 5 | 18.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|