C34H25N3O — CID 59751569
5-isocyano-6-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]-2-methylnaphthalene-1-carbonitrile (PubChem CID 59751569) has the molecular formula C34H25N3O and a molecular weight of 491.59 g/mol. Its IUPAC name is 5-isocyano-6-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]-2-methylnaphthalene-1-carbonitrile.
| Compound Name | 5-isocyano-6-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]-2-methylnaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 59751569 |
| Molecular Formula | C34H25N3O |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 5-isocyano-6-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]-2-methylnaphthalene-1-carbonitrile |
| SMILES | [C-]#[N+]c1c(C=Cc2ccc(N(c3ccccc3)c3ccc(OC)cc3)cc2)ccc2c(C#N)c(C)ccc12 |
| InChI | InChI=1S/C34H25N3O/c1-24-9-21-32-31(33(24)23-35)22-14-26(34(32)36-2)13-10-25-11-15-28(16-12-25)37(27-7-5-4-6-8-27)29-17-19-30(38-3)20-18-29/h4-22H,1,3H3 |
| InChIKey | JHYLDWCSXUFLRP-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|