C54H40N4 — CID 59060442
N-[4-[2-[1,5-diisocyano-6-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]ethenyl]phenyl]-4-methyl-N-phenylaniline (PubChem CID 59060442) has the molecular formula C54H40N4 and a molecular weight of 744.94 g/mol. Its IUPAC name is N-[4-[2-[1,5-diisocyano-6-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]ethenyl]phenyl]-4-methyl-N-phenylaniline.
| Compound Name | N-[4-[2-[1,5-diisocyano-6-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]ethenyl]phenyl]-4-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 59060442 |
| Molecular Formula | C54H40N4 |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | N-[4-[2-[1,5-diisocyano-6-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]ethenyl]phenyl]-4-methyl-N-phenylaniline |
| SMILES | [C-]#[N+]c1c(C=Cc2ccc(N(c3ccccc3)c3ccc(C)cc3)cc2)ccc2c([N+]#[C-])c(C=Cc3ccc(N(c4ccccc4)c4ccc(C)cc4)cc3)ccc12 |
| InChI | InChI=1S/C54H40N4/c1-39-15-29-47(30-16-39)57(45-11-7-5-8-12-45)49-33-21-41(22-34-49)19-25-43-27-37-52-51(53(43)55-3)38-28-44(54(52)56-4)26-20-42-23-35-50(36-24-42)58(46-13-9-6-10-14-46)48-31-17-40(2)18-32-48/h5-38H,1-2H3 |
| InChIKey | XVGNAQOACOVSQF-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 15.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|