C60H46N4O2 — CID 74010439
4-isocyano-2,5-bis[2-[4-(4-methoxy-N-(4-methylnaphthalen-1-yl)anilino)phenyl]ethenyl]benzonitrile (PubChem CID 74010439) has the molecular formula C60H46N4O2 and a molecular weight of 855.05 g/mol. Its IUPAC name is 4-isocyano-2,5-bis[2-[4-(4-methoxy-N-(4-methylnaphthalen-1-yl)anilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-isocyano-2,5-bis[2-[4-(4-methoxy-N-(4-methylnaphthalen-1-yl)anilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 74010439 |
| Molecular Formula | C60H46N4O2 |
| Molecular Weight | 855.05 g/mol |
| Exact Mass | 854.36 |
| IUPAC Name | 4-isocyano-2,5-bis[2-[4-(4-methoxy-N-(4-methylnaphthalen-1-yl)anilino)phenyl]ethenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(C=Cc2ccc(N(c3ccc(OC)cc3)c3ccc(C)c4ccccc34)cc2)c(C#N)cc1C=Cc1ccc(N(c2ccc(OC)cc2)c2ccc(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C60H46N4O2/c1-41-14-36-59(56-12-8-6-10-54(41)56)63(50-28-32-52(65-4)33-29-50)48-24-18-43(19-25-48)16-22-45-39-58(62-3)46(38-47(45)40-61)23-17-44-20-26-49(27-21-44)64(51-30-34-53(66-5)35-31-51)60-37-15-42(2)55-11-7-9-13-57(55)60/h6-39H,1-2,4-5H3 |
| InChIKey | LYNMZKSWFGUEAZ-UHFFFAOYSA-N |
| XLogP | 16.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.05 |
| LogP ≤ 5 | 16.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|