C104H84N8 — CID 91009952
4-isocyano-2,5-bis[(Z)-2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]ethenyl]benzonitrile (PubChem CID 91009952) has the molecular formula C104H84N8 and a molecular weight of 1445.87 g/mol. Its IUPAC name is 4-isocyano-2,5-bis[(Z)-2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-isocyano-2,5-bis[(Z)-2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 91009952 |
| Molecular Formula | C104H84N8 |
| Molecular Weight | 1445.87 g/mol |
| Exact Mass | 1444.68 |
| IUPAC Name | 4-isocyano-2,5-bis[(Z)-2-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]ethenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(/C=C\c2ccc(N(c3cccc(C)c3)c3cccc(C)c3)cc2)c(C#N)cc1/C=C\c1ccc(N(c2cccc(C)c2)c2cccc(C)c2)cc1.[C-]#[N+]c1cc(/C=C\c2ccc(N(c3cccc(C)c3)c3cccc(C)c3)cc2)c(C#N)cc1/C=C\c1ccc(N(c2cccc(C)c2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/2C52H42N4/c2*1-37-10-6-14-48(30-37)55(49-15-7-11-38(2)31-49)46-26-20-41(21-27-46)18-24-43-35-52(54-5)44(34-45(43)36-53)25-19-42-22-28-47(29-23-42)56(50-16-8-12-39(3)32-50)51-17-9-13-40(4)33-51/h2*6-35H,1-4H3/b2*24-18-,25-19- |
| InChIKey | CPKVVQBMEIRIIQ-XXHYUAPASA-N |
| XLogP | 29.25 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 112 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1445.87 |
| LogP ≤ 5 | 29.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|