C32H29N3O3 — CID 91279141
4-[3,4-bis(phenylmethoxy)phenyl]-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile (PubChem CID 91279141) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is 4-[3,4-bis(phenylmethoxy)phenyl]-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile.
| Compound Name | 4-[3,4-bis(phenylmethoxy)phenyl]-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 91279141 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 4-[3,4-bis(phenylmethoxy)phenyl]-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2cc(N(C)C)ccc2C(c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)C1C#N |
| InChI | InChI=1S/C32H29N3O3/c1-35(2)25-14-15-26-29(18-25)38-32(34)27(19-33)31(26)24-13-16-28(36-20-22-9-5-3-6-10-22)30(17-24)37-21-23-11-7-4-8-12-23/h3-18,27,31,34H,20-21H2,1-2H3/b34-32- |
| InChIKey | MKBAKUAGHFENIX-YJKCNMNRSA-N |
| XLogP | 6.55 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|