C19H15FN4O — CID 90828256
4-(3-cyano-4-fluorophenyl)-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile (PubChem CID 90828256) has the molecular formula C19H15FN4O and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-(3-cyano-4-fluorophenyl)-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile.
| Compound Name | 4-(3-cyano-4-fluorophenyl)-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 90828256 |
| Molecular Formula | C19H15FN4O |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-(3-cyano-4-fluorophenyl)-7-(dimethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2cc(N(C)C)ccc2C(c2ccc(F)c(C#N)c2)C1C#N |
| InChI | InChI=1S/C19H15FN4O/c1-24(2)13-4-5-14-17(8-13)25-19(23)15(10-22)18(14)11-3-6-16(20)12(7-11)9-21/h3-8,15,18,23H,1-2H3/b23-19- |
| InChIKey | BZGRPLOVVMCMHF-NMWGTECJSA-N |
| XLogP | 3.40 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|