C21H13F3N2O — CID 54373934
2-imino-4-[3-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carbonitrile (PubChem CID 54373934) has the molecular formula C21H13F3N2O and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-imino-4-[3-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carbonitrile.
| Compound Name | 2-imino-4-[3-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 54373934 |
| Molecular Formula | C21H13F3N2O |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-imino-4-[3-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(ccc3ccccc23)C(c2cccc(C(F)(F)F)c2)C1C#N |
| InChI | InChI=1S/C21H13F3N2O/c22-21(23,24)14-6-3-5-13(10-14)18-16-9-8-12-4-1-2-7-15(12)19(16)27-20(26)17(18)11-25/h1-10,17-18,26H/b26-20- |
| InChIKey | UVDSCHHGSGBZIQ-QOMWVZHYSA-N |
| XLogP | 5.50 |
| TPSA | 56.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|