C25H17FN3O3+ — CID 91898796
4-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 91898796) has the molecular formula C25H17FN3O3+ and a molecular weight of 426.43 g/mol. Its IUPAC name is 4-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 4-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 91898796 |
| Molecular Formula | C25H17FN3O3+ |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(c(=O)oc3ccccc23)C(c2cc[n+](Cc3cccc(F)c3)cc2)C1C#N |
| InChI | InChI=1S/C25H17FN3O3/c26-17-5-3-4-15(12-17)14-29-10-8-16(9-11-29)21-19(13-27)24(28)32-23-18-6-1-2-7-20(18)31-25(30)22(21)23/h1-12,19,21,28H,14H2/q+1/b28-24- |
| InChIKey | QGLOYLLBMWQQAJ-COOPMVRXSA-N |
| XLogP | 3.91 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|