C26H20N3O3+ — CID 72707681
2-amino-4-[1-[(3-methylphenyl)methyl]pyridin-1-ium-3-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 72707681) has the molecular formula C26H20N3O3+ and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-amino-4-[1-[(3-methylphenyl)methyl]pyridin-1-ium-3-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-[1-[(3-methylphenyl)methyl]pyridin-1-ium-3-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 72707681 |
| Molecular Formula | C26H20N3O3+ |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-amino-4-[1-[(3-methylphenyl)methyl]pyridin-1-ium-3-yl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | Cc1cccc(C[n+]2cccc(C3C(C#N)=C(N)Oc4c3c(=O)oc3ccccc43)c2)c1 |
| InChI | InChI=1S/C26H20N3O3/c1-16-6-4-7-17(12-16)14-29-11-5-8-18(15-29)22-20(13-27)25(28)32-24-19-9-2-3-10-21(19)31-26(30)23(22)24/h2-12,15,22H,14,28H2,1H3/q+1 |
| InChIKey | YSKRUFBOQNVROA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|