C23H18F3NO3 — CID 54060107
ethyl 2-imino-4-[2-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carboxylate (PubChem CID 54060107) has the molecular formula C23H18F3NO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is ethyl 2-imino-4-[2-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carboxylate.
| Compound Name | ethyl 2-imino-4-[2-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carboxylate |
|---|---|
| PubChem CID | 54060107 |
| Molecular Formula | C23H18F3NO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | ethyl 2-imino-4-[2-(trifluoromethyl)phenyl]-3,4-dihydrobenzo[h]chromene-3-carboxylate |
| SMILES | [H]/N=C1\Oc2c(ccc3ccccc23)C(c2ccccc2C(F)(F)F)C1C(=O)OCC |
| InChI | InChI=1S/C23H18F3NO3/c1-2-29-22(28)19-18(15-9-5-6-10-17(15)23(24,25)26)16-12-11-13-7-3-4-8-14(13)20(16)30-21(19)27/h3-12,18-19,27H,2H2,1H3/b27-21- |
| InChIKey | LZBQIDSWRPPBTB-MEFGMAGPSA-N |
| XLogP | 5.54 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|