C22H16F3NO3 — CID 123306148
ethyl 2-imino-4-(3,4,5-trifluorophenyl)-3,4-dihydrobenzo[g]chromene-3-carboxylate (PubChem CID 123306148) has the molecular formula C22H16F3NO3 and a molecular weight of 399.37 g/mol. Its IUPAC name is ethyl 2-imino-4-(3,4,5-trifluorophenyl)-3,4-dihydrobenzo[g]chromene-3-carboxylate.
| Compound Name | ethyl 2-imino-4-(3,4,5-trifluorophenyl)-3,4-dihydrobenzo[g]chromene-3-carboxylate |
|---|---|
| PubChem CID | 123306148 |
| Molecular Formula | C22H16F3NO3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | ethyl 2-imino-4-(3,4,5-trifluorophenyl)-3,4-dihydrobenzo[g]chromene-3-carboxylate |
| SMILES | [H]/N=C1\Oc2cc3ccccc3cc2C(c2cc(F)c(F)c(F)c2)C1C(=O)OCC |
| InChI | InChI=1S/C22H16F3NO3/c1-2-28-22(27)19-18(13-8-15(23)20(25)16(24)9-13)14-7-11-5-3-4-6-12(11)10-17(14)29-21(19)26/h3-10,18-19,26H,2H2,1H3/b26-21- |
| InChIKey | ZYTCMGYZLWVLSS-QLYXXIJNSA-N |
| XLogP | 4.94 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|