C20H18N2O3 — CID 91545047
ethyl 2-(3-cyano-2-imino-6-phenyl-3,4-dihydrochromen-4-yl)acetate (PubChem CID 91545047) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is ethyl 2-(3-cyano-2-imino-6-phenyl-3,4-dihydrochromen-4-yl)acetate.
| Compound Name | ethyl 2-(3-cyano-2-imino-6-phenyl-3,4-dihydrochromen-4-yl)acetate |
|---|---|
| PubChem CID | 91545047 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | ethyl 2-(3-cyano-2-imino-6-phenyl-3,4-dihydrochromen-4-yl)acetate |
| SMILES | [H]/N=C1\Oc2ccc(-c3ccccc3)cc2C(CC(=O)OCC)C1C#N |
| InChI | InChI=1S/C20H18N2O3/c1-2-24-19(23)11-15-16-10-14(13-6-4-3-5-7-13)8-9-18(16)25-20(22)17(15)12-21/h3-10,15,17,22H,2,11H2,1H3/b22-20- |
| InChIKey | DEKJMNZDIMUZIM-XDOYNYLZSA-N |
| XLogP | 3.90 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|