C20H20F3NO2 — CID 90809176
ethyl (5S)-1-benzyl-5-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylate (PubChem CID 90809176) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is ethyl (5S)-1-benzyl-5-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (5S)-1-benzyl-5-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90809176 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | ethyl (5S)-1-benzyl-5-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CC[C@@H](c2cc(F)c(F)c(F)c2)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H20F3NO2/c1-2-26-20(25)18-9-8-17(14-10-15(21)19(23)16(22)11-14)24(18)12-13-6-4-3-5-7-13/h3-7,10-11,17-18H,2,8-9,12H2,1H3/t17-,18?/m0/s1 |
| InChIKey | LRRSRGXIRKGSLT-ZENAZSQFSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|