C23H20FNO4 — CID 123232182
ethyl 4-(4-fluorophenyl)-2-imino-6-methoxy-3,4-dihydrobenzo[h]chromene-3-carboxylate (PubChem CID 123232182) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-imino-6-methoxy-3,4-dihydrobenzo[h]chromene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-imino-6-methoxy-3,4-dihydrobenzo[h]chromene-3-carboxylate |
|---|---|
| PubChem CID | 123232182 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-imino-6-methoxy-3,4-dihydrobenzo[h]chromene-3-carboxylate |
| SMILES | [H]/N=C1\Oc2c(cc(OC)c3ccccc23)C(c2ccc(F)cc2)C1C(=O)OCC |
| InChI | InChI=1S/C23H20FNO4/c1-3-28-23(26)20-19(13-8-10-14(24)11-9-13)17-12-18(27-2)15-6-4-5-7-16(15)21(17)29-22(20)25/h4-12,19-20,25H,3H2,1-2H3/b25-22- |
| InChIKey | UDAUFNGUXVHSRP-LVWGJNHUSA-N |
| XLogP | 4.67 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|