C12H13NO3S — CID 585137
ethyl 2-imino-5-phenyl-1,3-oxathiolane-4-carboxylate (PubChem CID 585137) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is ethyl 2-imino-5-phenyl-1,3-oxathiolane-4-carboxylate.
| Compound Name | ethyl 2-imino-5-phenyl-1,3-oxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 585137 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | ethyl 2-imino-5-phenyl-1,3-oxathiolane-4-carboxylate |
| SMILES | [H]/N=C1/OC(c2ccccc2)C(C(=O)OCC)S1 |
| InChI | InChI=1S/C12H13NO3S/c1-2-15-11(14)10-9(16-12(13)17-10)8-6-4-3-5-7-8/h3-7,9-10,13H,2H2,1H3/b13-12- |
| InChIKey | SJLRDEVCMDULHG-SEYXRHQNSA-N |
| XLogP | 2.36 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|