C14H13F3N4O2S — CID 5295663
ethyl 6-phenyl-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate (PubChem CID 5295663) has the molecular formula C14H13F3N4O2S and a molecular weight of 358.35 g/mol. Its IUPAC name is ethyl 6-phenyl-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate.
| Compound Name | ethyl 6-phenyl-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 5295663 |
| Molecular Formula | C14H13F3N4O2S |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | ethyl 6-phenyl-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylate |
| SMILES | CCOC(=O)C1Sc2nnc(C(F)(F)F)n2NC1c1ccccc1 |
| InChI | InChI=1S/C14H13F3N4O2S/c1-2-23-11(22)10-9(8-6-4-3-5-7-8)20-21-12(14(15,16)17)18-19-13(21)24-10/h3-7,9-10,20H,2H2,1H3 |
| InChIKey | VVQMLZRWAQZMQM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |