C19H14ClF3N4OS — CID 2374906
[(6S,7S)-6-(4-chlorophenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone (PubChem CID 2374906) has the molecular formula C19H14ClF3N4OS and a molecular weight of 438.86 g/mol. Its IUPAC name is [(6S,7S)-6-(4-chlorophenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone.
| Compound Name | [(6S,7S)-6-(4-chlorophenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 2374906 |
| Molecular Formula | C19H14ClF3N4OS |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | [(6S,7S)-6-(4-chlorophenyl)-3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[C@H]2Sc3nnc(C(F)(F)F)n3N[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H14ClF3N4OS/c1-10-2-4-12(5-3-10)15(28)16-14(11-6-8-13(20)9-7-11)26-27-17(19(21,22)23)24-25-18(27)29-16/h2-9,14,16,26H,1H3/t14-,16-/m0/s1 |
| InChIKey | SRKWPRWSDGVEGZ-HOCLYGCPSA-N |
| XLogP | 4.90 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |