C19H17N5O3S — CID 2387040
[(6R,7R)-3-methyl-6-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone (PubChem CID 2387040) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is [(6R,7R)-3-methyl-6-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone.
| Compound Name | [(6R,7R)-3-methyl-6-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 2387040 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [(6R,7R)-3-methyl-6-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[C@@H]2Sc3nnc(C)n3N[C@@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H17N5O3S/c1-11-6-8-13(9-7-11)17(25)18-16(14-4-3-5-15(10-14)24(26)27)22-23-12(2)20-21-19(23)28-18/h3-10,16,18,22H,1-2H3/t16-,18-/m1/s1 |
| InChIKey | BQYJONJSXAWBKD-SJLPKXTDSA-N |
| XLogP | 3.45 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|