C12H12N4O2S — CID 4771080
3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylic acid (PubChem CID 4771080) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylic acid.
| Compound Name | 3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylic acid |
|---|---|
| PubChem CID | 4771080 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxylic acid |
| SMILES | Cc1nnc2n1NC(c1ccccc1)C(C(=O)O)S2 |
| InChI | InChI=1S/C12H12N4O2S/c1-7-13-14-12-16(7)15-9(10(19-12)11(17)18)8-5-3-2-4-6-8/h2-6,9-10,15H,1H3,(H,17,18) |
| InChIKey | NUYVNMSAWPTMFS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |