C18H23N5OS — CID 40980925
azepan-1-yl-[(6S,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone (PubChem CID 40980925) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is azepan-1-yl-[(6S,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone.
| Compound Name | azepan-1-yl-[(6S,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
|---|---|
| PubChem CID | 40980925 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | azepan-1-yl-[(6S,7R)-3-methyl-6-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
| SMILES | Cc1nnc2n1N[C@@H](c1ccccc1)[C@H](C(=O)N1CCCCCC1)S2 |
| InChI | InChI=1S/C18H23N5OS/c1-13-19-20-18-23(13)21-15(14-9-5-4-6-10-14)16(25-18)17(24)22-11-7-2-3-8-12-22/h4-6,9-10,15-16,21H,2-3,7-8,11-12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | LGTDAIHMXCJEBS-JKSUJKDBSA-N |
| XLogP | 2.75 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |