C19H25N5O2S — CID 92651425
azepan-1-yl-[(6R,7R)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone (PubChem CID 92651425) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is azepan-1-yl-[(6R,7R)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone.
| Compound Name | azepan-1-yl-[(6R,7R)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
|---|---|
| PubChem CID | 92651425 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | azepan-1-yl-[(6R,7R)-6-(4-methoxyphenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
| SMILES | COc1ccc([C@H]2Nn3c(C)nnc3S[C@H]2C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H25N5O2S/c1-13-20-21-19-24(13)22-16(14-7-9-15(26-2)10-8-14)17(27-19)18(25)23-11-5-3-4-6-12-23/h7-10,16-17,22H,3-6,11-12H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | JQRXTXHCBZKXSY-IAGOWNOFSA-N |
| XLogP | 2.76 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |