C25H29N5O2S — CID 17088242
azepan-1-yl-[6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone (PubChem CID 17088242) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is azepan-1-yl-[6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone.
| Compound Name | azepan-1-yl-[6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
|---|---|
| PubChem CID | 17088242 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | azepan-1-yl-[6-(4-ethoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
| SMILES | CCOc1ccc(C2Nn3c(nnc3-c3ccccc3)SC2C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C25H29N5O2S/c1-2-32-20-14-12-18(13-15-20)21-22(24(31)29-16-8-3-4-9-17-29)33-25-27-26-23(30(25)28-21)19-10-6-5-7-11-19/h5-7,10-15,21-22,28H,2-4,8-9,16-17H2,1H3 |
| InChIKey | KANXUCBPVIKHSM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |