C23H25N5OS — CID 40978987
azepan-1-yl-[(6R,7R)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone (PubChem CID 40978987) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is azepan-1-yl-[(6R,7R)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone.
| Compound Name | azepan-1-yl-[(6R,7R)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
|---|---|
| PubChem CID | 40978987 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | azepan-1-yl-[(6R,7R)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
| SMILES | O=C([C@@H]1Sc2nnc(-c3ccccc3)n2N[C@@H]1c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C23H25N5OS/c29-22(27-15-9-1-2-10-16-27)20-19(17-11-5-3-6-12-17)26-28-21(24-25-23(28)30-20)18-13-7-4-8-14-18/h3-8,11-14,19-20,26H,1-2,9-10,15-16H2/t19-,20-/m1/s1 |
| InChIKey | FFAVYXLTWJKJFB-WOJBJXKFSA-N |
| XLogP | 4.11 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |