C24H27N5OS — CID 124834475
[(6S,7S)-6-(4-methylphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[(2R)-2-methylpiperidin-1-yl]methanone (PubChem CID 124834475) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is [(6S,7S)-6-(4-methylphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[(2R)-2-methylpiperidin-1-yl]methanone.
| Compound Name | [(6S,7S)-6-(4-methylphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[(2R)-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124834475 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [(6S,7S)-6-(4-methylphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[(2R)-2-methylpiperidin-1-yl]methanone |
| SMILES | Cc1ccc([C@@H]2Nn3c(nnc3-c3ccccc3)S[C@@H]2C(=O)N2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C24H27N5OS/c1-16-11-13-18(14-12-16)20-21(23(30)28-15-7-6-8-17(28)2)31-24-26-25-22(29(24)27-20)19-9-4-3-5-10-19/h3-5,9-14,17,20-21,27H,6-8,15H2,1-2H3/t17-,20+,21+/m1/s1 |
| InChIKey | LPGWRXCPBZMJIC-QMMLZNLJSA-N |
| XLogP | 4.41 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |