C24H26ClN5O2S — CID 17088288
[6-(3-chloro-4-methoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(2-methylpiperidin-1-yl)methanone (PubChem CID 17088288) has the molecular formula C24H26ClN5O2S and a molecular weight of 484.03 g/mol. Its IUPAC name is [6-(3-chloro-4-methoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(2-methylpiperidin-1-yl)methanone.
| Compound Name | [6-(3-chloro-4-methoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 17088288 |
| Molecular Formula | C24H26ClN5O2S |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [6-(3-chloro-4-methoxyphenyl)-3-phenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-(2-methylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(C2Nn3c(nnc3-c3ccccc3)SC2C(=O)N2CCCCC2C)cc1Cl |
| InChI | InChI=1S/C24H26ClN5O2S/c1-15-8-6-7-13-29(15)23(31)21-20(17-11-12-19(32-2)18(25)14-17)28-30-22(26-27-24(30)33-21)16-9-4-3-5-10-16/h3-5,9-12,14-15,20-21,28H,6-8,13H2,1-2H3 |
| InChIKey | JNNCWLOWTZCVNP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |